C32H46O6S2Si2 — CID 23254497
[(3S,5S)-5-(benzenesulfonyl)-1-[tert-butyl(diphenyl)silyl]oxy-6-trimethylsilylhexan-3-yl] methanesulfonate (PubChem CID 23254497) has the molecular formula C32H46O6S2Si2 and a molecular weight of 647.02 g/mol. Its IUPAC name is [(3S,5S)-5-(benzenesulfonyl)-1-[tert-butyl(diphenyl)silyl]oxy-6-trimethylsilylhexan-3-yl] methanesulfonate.
| Compound Name | [(3S,5S)-5-(benzenesulfonyl)-1-[tert-butyl(diphenyl)silyl]oxy-6-trimethylsilylhexan-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 23254497 |
| Molecular Formula | C32H46O6S2Si2 |
| Molecular Weight | 647.02 g/mol |
| Exact Mass | 646.23 |
| IUPAC Name | [(3S,5S)-5-(benzenesulfonyl)-1-[tert-butyl(diphenyl)silyl]oxy-6-trimethylsilylhexan-3-yl] methanesulfonate |
| SMILES | CC(C)(C)[Si](OCC[C@@H](C[C@@H](C[Si](C)(C)C)S(=O)(=O)c1ccccc1)OS(C)(=O)=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H46O6S2Si2/c1-32(2,3)42(30-19-13-9-14-20-30,31-21-15-10-16-22-31)37-24-23-27(38-39(4,33)34)25-29(26-41(5,6)7)40(35,36)28-17-11-8-12-18-28/h8-22,27,29H,23-26H2,1-7H3/t27-,29-/m0/s1 |
| InChIKey | JBHIDMKSHBDVER-YTMVLYRLSA-N |
| XLogP | 5.87 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.02 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|