C6H11NO3S — CID 23255920
(3aR)-3,3a,4,5,6,7-hexahydrooxathiazolo[3,4-a]pyridine 1,1-dioxide (PubChem CID 23255920) has the molecular formula C6H11NO3S and a molecular weight of 177.22 g/mol. Its IUPAC name is (3aR)-3,3a,4,5,6,7-hexahydrooxathiazolo[3,4-a]pyridine 1,1-dioxide.
| Compound Name | (3aR)-3,3a,4,5,6,7-hexahydrooxathiazolo[3,4-a]pyridine 1,1-dioxide |
|---|---|
| PubChem CID | 23255920 |
| Molecular Formula | C6H11NO3S |
| Molecular Weight | 177.22 g/mol |
| Exact Mass | 177.05 |
| IUPAC Name | (3aR)-3,3a,4,5,6,7-hexahydrooxathiazolo[3,4-a]pyridine 1,1-dioxide |
| SMILES | O=S1(=O)OC[C@H]2CCCCN21 |
| InChI | InChI=1S/C6H11NO3S/c8-11(9)7-4-2-1-3-6(7)5-10-11/h6H,1-5H2/t6-/m1/s1 |
| InChIKey | OYVIFLMZUOOUOL-ZCFIWIBFSA-N |
| XLogP | 0.12 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.22 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |