C23H28O7 — CID 23259989
[(R)-(7-methoxy-2-oxochromen-6-yl)-[(4S)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]methyl] (E)-2-methylbut-2-enoate (PubChem CID 23259989) has the molecular formula C23H28O7 and a molecular weight of 416.47 g/mol. Its IUPAC name is [(R)-(7-methoxy-2-oxochromen-6-yl)-[(4S)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]methyl] (E)-2-methylbut-2-enoate.
| Compound Name | [(R)-(7-methoxy-2-oxochromen-6-yl)-[(4S)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]methyl] (E)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 23259989 |
| Molecular Formula | C23H28O7 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | [(R)-(7-methoxy-2-oxochromen-6-yl)-[(4S)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]methyl] (E)-2-methylbut-2-enoate |
| SMILES | C/C=C(\C)C(=O)O[C@H](c1cc2ccc(=O)oc2cc1OC)[C@@H]1OC(C)(C)OC1(C)C |
| InChI | InChI=1S/C23H28O7/c1-8-13(2)21(25)28-19(20-22(3,4)30-23(5,6)29-20)15-11-14-9-10-18(24)27-16(14)12-17(15)26-7/h8-12,19-20H,1-7H3/b13-8+/t19-,20+/m1/s1 |
| InChIKey | YMVDDLDKESKNJK-SUFKLLJCSA-N |
| XLogP | 4.28 |
| TPSA | 84.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|