C14H17ClSe — CID 23267193
(2-chloro-5,5-dimethylhex-3-ynyl)selanylbenzene (PubChem CID 23267193) has the molecular formula C14H17ClSe and a molecular weight of 299.70 g/mol. Its IUPAC name is (2-chloro-5,5-dimethylhex-3-ynyl)selanylbenzene.
| Compound Name | (2-chloro-5,5-dimethylhex-3-ynyl)selanylbenzene |
|---|---|
| PubChem CID | 23267193 |
| Molecular Formula | C14H17ClSe |
| Molecular Weight | 299.70 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | (2-chloro-5,5-dimethylhex-3-ynyl)selanylbenzene |
| SMILES | CC(C)(C)C#CC(Cl)C[Se]c1ccccc1 |
| InChI | InChI=1S/C14H17ClSe/c1-14(2,3)10-9-12(15)11-16-13-7-5-4-6-8-13/h4-8,12H,11H2,1-3H3 |
| InChIKey | MSXQFKJFOUPKKH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.70 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|