C16H12ClNO6S-2 — CID 2327725
3-[[(1S)-1-carboxylato-2-phenylethyl]sulfamoyl]-4-chlorobenzoate (PubChem CID 2327725) has the molecular formula C16H12ClNO6S-2 and a molecular weight of 381.79 g/mol. Its IUPAC name is 3-[[(1S)-1-carboxylato-2-phenylethyl]sulfamoyl]-4-chlorobenzoate.
| Compound Name | 3-[[(1S)-1-carboxylato-2-phenylethyl]sulfamoyl]-4-chlorobenzoate |
|---|---|
| PubChem CID | 2327725 |
| Molecular Formula | C16H12ClNO6S-2 |
| Molecular Weight | 381.79 g/mol |
| Exact Mass | 381.01 |
| IUPAC Name | 3-[[(1S)-1-carboxylato-2-phenylethyl]sulfamoyl]-4-chlorobenzoate |
| SMILES | O=C([O-])c1ccc(Cl)c(S(=O)(=O)N[C@@H](Cc2ccccc2)C(=O)[O-])c1 |
| InChI | InChI=1S/C16H14ClNO6S/c17-12-7-6-11(15(19)20)9-14(12)25(23,24)18-13(16(21)22)8-10-4-2-1-3-5-10/h1-7,9,13,18H,8H2,(H,19,20)(H,21,22)/p-2/t13-/m0/s1 |
| InChIKey | YKRHKLIAUYRZDG-ZDUSSCGKSA-L |
| XLogP | -0.66 |
| TPSA | 126.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.79 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |