C13H14ClNO6S-2 — CID 2327733
3-[[(1R,2R)-1-carboxylato-2-methylbutyl]sulfamoyl]-4-chlorobenzoate (PubChem CID 2327733) has the molecular formula C13H14ClNO6S-2 and a molecular weight of 347.78 g/mol. Its IUPAC name is 3-[[(1R,2R)-1-carboxylato-2-methylbutyl]sulfamoyl]-4-chlorobenzoate.
| Compound Name | 3-[[(1R,2R)-1-carboxylato-2-methylbutyl]sulfamoyl]-4-chlorobenzoate |
|---|---|
| PubChem CID | 2327733 |
| Molecular Formula | C13H14ClNO6S-2 |
| Molecular Weight | 347.78 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | 3-[[(1R,2R)-1-carboxylato-2-methylbutyl]sulfamoyl]-4-chlorobenzoate |
| SMILES | CC[C@@H](C)[C@@H](NS(=O)(=O)c1cc(C(=O)[O-])ccc1Cl)C(=O)[O-] |
| InChI | InChI=1S/C13H16ClNO6S/c1-3-7(2)11(13(18)19)15-22(20,21)10-6-8(12(16)17)4-5-9(10)14/h4-7,11,15H,3H2,1-2H3,(H,16,17)(H,18,19)/p-2/t7-,11-/m1/s1 |
| InChIKey | BFVLJADCRQKHHY-RDDDGLTNSA-L |
| XLogP | -0.85 |
| TPSA | 126.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.78 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |