C35H35NO6 — CID 23307608
(2R)-2-benzyl-1-[5-(4-hydroxybutyl)-4-(3-methylphenyl)furan-2-yl]-3-[(4S,5R)-4-methyl-2-oxo-5-phenyl-1,3-oxazolidin-3-yl]propane-1,3-dione (PubChem CID 23307608) has the molecular formula C35H35NO6 and a molecular weight of 565.67 g/mol. Its IUPAC name is (2R)-2-benzyl-1-[5-(4-hydroxybutyl)-4-(3-methylphenyl)furan-2-yl]-3-[(4S,5R)-4-methyl-2-oxo-5-phenyl-1,3-oxazolidin-3-yl]propane-1,3-dione.
| Compound Name | (2R)-2-benzyl-1-[5-(4-hydroxybutyl)-4-(3-methylphenyl)furan-2-yl]-3-[(4S,5R)-4-methyl-2-oxo-5-phenyl-1,3-oxazolidin-3-yl]propane-1,3-dione |
|---|---|
| PubChem CID | 23307608 |
| Molecular Formula | C35H35NO6 |
| Molecular Weight | 565.67 g/mol |
| Exact Mass | 565.25 |
| IUPAC Name | (2R)-2-benzyl-1-[5-(4-hydroxybutyl)-4-(3-methylphenyl)furan-2-yl]-3-[(4S,5R)-4-methyl-2-oxo-5-phenyl-1,3-oxazolidin-3-yl]propane-1,3-dione |
| SMILES | Cc1cccc(-c2cc(C(=O)[C@@H](Cc3ccccc3)C(=O)N3C(=O)O[C@H](c4ccccc4)[C@@H]3C)oc2CCCCO)c1 |
| InChI | InChI=1S/C35H35NO6/c1-23-12-11-17-27(20-23)28-22-31(41-30(28)18-9-10-19-37)32(38)29(21-25-13-5-3-6-14-25)34(39)36-24(2)33(42-35(36)40)26-15-7-4-8-16-26/h3-8,11-17,20,22,24,29,33,37H,9-10,18-19,21H2,1-2H3/t24-,29+,33-/m0/s1 |
| InChIKey | KPLZRXIHZWGRPH-BPXGCVMRSA-N |
| XLogP | 6.72 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.67 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|