C28H29NO7 — CID 6708950
(2S)-1-[5-(4-hydroxybutyl)-4-(3-methylphenyl)furan-2-yl]-2-methoxy-3-[(4S)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]propane-1,3-dione (PubChem CID 6708950) has the molecular formula C28H29NO7 and a molecular weight of 491.54 g/mol. Its IUPAC name is (2S)-1-[5-(4-hydroxybutyl)-4-(3-methylphenyl)furan-2-yl]-2-methoxy-3-[(4S)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]propane-1,3-dione.
| Compound Name | (2S)-1-[5-(4-hydroxybutyl)-4-(3-methylphenyl)furan-2-yl]-2-methoxy-3-[(4S)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]propane-1,3-dione |
|---|---|
| PubChem CID | 6708950 |
| Molecular Formula | C28H29NO7 |
| Molecular Weight | 491.54 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | (2S)-1-[5-(4-hydroxybutyl)-4-(3-methylphenyl)furan-2-yl]-2-methoxy-3-[(4S)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]propane-1,3-dione |
| SMILES | CO[C@@H](C(=O)c1cc(-c2cccc(C)c2)c(CCCCO)o1)C(=O)N1C(=O)OC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C28H29NO7/c1-18-9-8-12-20(15-18)21-16-24(36-23(21)13-6-7-14-30)25(31)26(34-2)27(32)29-22(17-35-28(29)33)19-10-4-3-5-11-19/h3-5,8-12,15-16,22,26,30H,6-7,13-14,17H2,1-2H3/t22-,26+/m1/s1 |
| InChIKey | VXTDEADYLKBTFG-GJZUVCINSA-N |
| XLogP | 4.49 |
| TPSA | 106.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.54 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|