C31H35NO6 — CID 6667677
(2R)-1-[(4R)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-3-[5-(6-hydroxyhexyl)-4-(3-methylphenyl)furan-2-yl]-2-methylpropane-1,3-dione (PubChem CID 6667677) has the molecular formula C31H35NO6 and a molecular weight of 517.62 g/mol. Its IUPAC name is (2R)-1-[(4R)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-3-[5-(6-hydroxyhexyl)-4-(3-methylphenyl)furan-2-yl]-2-methylpropane-1,3-dione.
| Compound Name | (2R)-1-[(4R)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-3-[5-(6-hydroxyhexyl)-4-(3-methylphenyl)furan-2-yl]-2-methylpropane-1,3-dione |
|---|---|
| PubChem CID | 6667677 |
| Molecular Formula | C31H35NO6 |
| Molecular Weight | 517.62 g/mol |
| Exact Mass | 517.25 |
| IUPAC Name | (2R)-1-[(4R)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-3-[5-(6-hydroxyhexyl)-4-(3-methylphenyl)furan-2-yl]-2-methylpropane-1,3-dione |
| SMILES | Cc1cccc(-c2cc(C(=O)[C@@H](C)C(=O)N3C(=O)OC[C@H]3Cc3ccccc3)oc2CCCCCCO)c1 |
| InChI | InChI=1S/C31H35NO6/c1-21-11-10-14-24(17-21)26-19-28(38-27(26)15-8-3-4-9-16-33)29(34)22(2)30(35)32-25(20-37-31(32)36)18-23-12-6-5-7-13-23/h5-7,10-14,17,19,22,25,33H,3-4,8-9,15-16,18,20H2,1-2H3/t22-,25-/m1/s1 |
| InChIKey | UNGZYUUAOIYWHL-RCZVLFRGSA-N |
| XLogP | 5.76 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.62 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|