C40H45NO6 — CID 23307787
(2R)-2-benzyl-1-[5-(10-hydroxydecyl)-4-(3-methylphenyl)furan-2-yl]-3-[(4S)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]propane-1,3-dione (PubChem CID 23307787) has the molecular formula C40H45NO6 and a molecular weight of 635.80 g/mol. Its IUPAC name is (2R)-2-benzyl-1-[5-(10-hydroxydecyl)-4-(3-methylphenyl)furan-2-yl]-3-[(4S)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]propane-1,3-dione.
| Compound Name | (2R)-2-benzyl-1-[5-(10-hydroxydecyl)-4-(3-methylphenyl)furan-2-yl]-3-[(4S)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]propane-1,3-dione |
|---|---|
| PubChem CID | 23307787 |
| Molecular Formula | C40H45NO6 |
| Molecular Weight | 635.80 g/mol |
| Exact Mass | 635.32 |
| IUPAC Name | (2R)-2-benzyl-1-[5-(10-hydroxydecyl)-4-(3-methylphenyl)furan-2-yl]-3-[(4S)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]propane-1,3-dione |
| SMILES | Cc1cccc(-c2cc(C(=O)[C@@H](Cc3ccccc3)C(=O)N3C(=O)OC[C@@H]3c3ccccc3)oc2CCCCCCCCCCO)c1 |
| InChI | InChI=1S/C40H45NO6/c1-29-17-16-22-32(25-29)33-27-37(47-36(33)23-14-6-4-2-3-5-7-15-24-42)38(43)34(26-30-18-10-8-11-19-30)39(44)41-35(28-46-40(41)45)31-20-12-9-13-21-31/h8-13,16-22,25,27,34-35,42H,2-7,14-15,23-24,26,28H2,1H3/t34-,35-/m1/s1 |
| InChIKey | OHLCYRMDPCDNBY-VSJLXWSYSA-N |
| XLogP | 8.67 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.80 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|