C31H35NO7 — CID 6667909
(2R)-1-[5-(6-hydroxyhexyl)-4-(3-methylphenyl)furan-2-yl]-2-methoxy-3-[(4R,5S)-4-methyl-2-oxo-5-phenyl-1,3-oxazolidin-3-yl]propane-1,3-dione (PubChem CID 6667909) has the molecular formula C31H35NO7 and a molecular weight of 533.62 g/mol. Its IUPAC name is (2R)-1-[5-(6-hydroxyhexyl)-4-(3-methylphenyl)furan-2-yl]-2-methoxy-3-[(4R,5S)-4-methyl-2-oxo-5-phenyl-1,3-oxazolidin-3-yl]propane-1,3-dione.
| Compound Name | (2R)-1-[5-(6-hydroxyhexyl)-4-(3-methylphenyl)furan-2-yl]-2-methoxy-3-[(4R,5S)-4-methyl-2-oxo-5-phenyl-1,3-oxazolidin-3-yl]propane-1,3-dione |
|---|---|
| PubChem CID | 6667909 |
| Molecular Formula | C31H35NO7 |
| Molecular Weight | 533.62 g/mol |
| Exact Mass | 533.24 |
| IUPAC Name | (2R)-1-[5-(6-hydroxyhexyl)-4-(3-methylphenyl)furan-2-yl]-2-methoxy-3-[(4R,5S)-4-methyl-2-oxo-5-phenyl-1,3-oxazolidin-3-yl]propane-1,3-dione |
| SMILES | CO[C@H](C(=O)c1cc(-c2cccc(C)c2)c(CCCCCCO)o1)C(=O)N1C(=O)O[C@@H](c2ccccc2)[C@H]1C |
| InChI | InChI=1S/C31H35NO7/c1-20-12-11-15-23(18-20)24-19-26(38-25(24)16-9-4-5-10-17-33)27(34)29(37-3)30(35)32-21(2)28(39-31(32)36)22-13-7-6-8-14-22/h6-8,11-15,18-19,21,28-29,33H,4-5,9-10,16-17H2,1-3H3/t21-,28-,29-/m1/s1 |
| InChIKey | ZMEGWBBRHXIDQW-HBTXSTMGSA-N |
| XLogP | 5.66 |
| TPSA | 106.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.62 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|