C29H31NO7 — CID 4195882
1-(4-benzyl-2-oxo-1,3-oxazolidin-3-yl)-3-[5-(4-hydroxybutyl)-4-(3-methylphenyl)furan-2-yl]-2-methoxypropane-1,3-dione (PubChem CID 4195882) has the molecular formula C29H31NO7 and a molecular weight of 505.57 g/mol. Its IUPAC name is 1-(4-benzyl-2-oxo-1,3-oxazolidin-3-yl)-3-[5-(4-hydroxybutyl)-4-(3-methylphenyl)furan-2-yl]-2-methoxypropane-1,3-dione.
| Compound Name | 1-(4-benzyl-2-oxo-1,3-oxazolidin-3-yl)-3-[5-(4-hydroxybutyl)-4-(3-methylphenyl)furan-2-yl]-2-methoxypropane-1,3-dione |
|---|---|
| PubChem CID | 4195882 |
| Molecular Formula | C29H31NO7 |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.21 |
| IUPAC Name | 1-(4-benzyl-2-oxo-1,3-oxazolidin-3-yl)-3-[5-(4-hydroxybutyl)-4-(3-methylphenyl)furan-2-yl]-2-methoxypropane-1,3-dione |
| SMILES | COC(C(=O)c1cc(-c2cccc(C)c2)c(CCCCO)o1)C(=O)N1C(=O)OCC1Cc1ccccc1 |
| InChI | InChI=1S/C29H31NO7/c1-19-9-8-12-21(15-19)23-17-25(37-24(23)13-6-7-14-31)26(32)27(35-2)28(33)30-22(18-36-29(30)34)16-20-10-4-3-5-11-20/h3-5,8-12,15,17,22,27,31H,6-7,13-14,16,18H2,1-2H3 |
| InChIKey | NWHYCFOFQMYLTR-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 106.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|