C30H33NO6 — CID 4199144
1-[5-(6-hydroxyhexyl)-4-(3-methylphenyl)furan-2-yl]-2-methyl-3-(2-oxo-4-phenyl-1,3-oxazolidin-3-yl)propane-1,3-dione (PubChem CID 4199144) has the molecular formula C30H33NO6 and a molecular weight of 503.60 g/mol. Its IUPAC name is 1-[5-(6-hydroxyhexyl)-4-(3-methylphenyl)furan-2-yl]-2-methyl-3-(2-oxo-4-phenyl-1,3-oxazolidin-3-yl)propane-1,3-dione.
| Compound Name | 1-[5-(6-hydroxyhexyl)-4-(3-methylphenyl)furan-2-yl]-2-methyl-3-(2-oxo-4-phenyl-1,3-oxazolidin-3-yl)propane-1,3-dione |
|---|---|
| PubChem CID | 4199144 |
| Molecular Formula | C30H33NO6 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | 1-[5-(6-hydroxyhexyl)-4-(3-methylphenyl)furan-2-yl]-2-methyl-3-(2-oxo-4-phenyl-1,3-oxazolidin-3-yl)propane-1,3-dione |
| SMILES | Cc1cccc(-c2cc(C(=O)C(C)C(=O)N3C(=O)OCC3c3ccccc3)oc2CCCCCCO)c1 |
| InChI | InChI=1S/C30H33NO6/c1-20-11-10-14-23(17-20)24-18-27(37-26(24)15-8-3-4-9-16-32)28(33)21(2)29(34)31-25(19-36-30(31)35)22-12-6-5-7-13-22/h5-7,10-14,17-18,21,25,32H,3-4,8-9,15-16,19H2,1-2H3 |
| InChIKey | IFJYQZLERWGIHT-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|