C30H33NO7 — CID 4251501
1-[5-(6-hydroxyhexyl)-4-(3-methylphenyl)furan-2-yl]-2-methoxy-3-(2-oxo-4-phenyl-1,3-oxazolidin-3-yl)propane-1,3-dione (PubChem CID 4251501) has the molecular formula C30H33NO7 and a molecular weight of 519.59 g/mol. Its IUPAC name is 1-[5-(6-hydroxyhexyl)-4-(3-methylphenyl)furan-2-yl]-2-methoxy-3-(2-oxo-4-phenyl-1,3-oxazolidin-3-yl)propane-1,3-dione.
| Compound Name | 1-[5-(6-hydroxyhexyl)-4-(3-methylphenyl)furan-2-yl]-2-methoxy-3-(2-oxo-4-phenyl-1,3-oxazolidin-3-yl)propane-1,3-dione |
|---|---|
| PubChem CID | 4251501 |
| Molecular Formula | C30H33NO7 |
| Molecular Weight | 519.59 g/mol |
| Exact Mass | 519.23 |
| IUPAC Name | 1-[5-(6-hydroxyhexyl)-4-(3-methylphenyl)furan-2-yl]-2-methoxy-3-(2-oxo-4-phenyl-1,3-oxazolidin-3-yl)propane-1,3-dione |
| SMILES | COC(C(=O)c1cc(-c2cccc(C)c2)c(CCCCCCO)o1)C(=O)N1C(=O)OCC1c1ccccc1 |
| InChI | InChI=1S/C30H33NO7/c1-20-11-10-14-22(17-20)23-18-26(38-25(23)15-8-3-4-9-16-32)27(33)28(36-2)29(34)31-24(19-37-30(31)35)21-12-6-5-7-13-21/h5-7,10-14,17-18,24,28,32H,3-4,8-9,15-16,19H2,1-2H3 |
| InChIKey | XJTUSBZLTVRLEZ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 106.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.59 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|