C28H48N4O — CID 23310914
2-phenyl-N,2-bis(2,4,6,6-tetramethylpiperidin-2-yl)butanehydrazide (PubChem CID 23310914) has the molecular formula C28H48N4O and a molecular weight of 456.72 g/mol. Its IUPAC name is 2-phenyl-N,2-bis(2,4,6,6-tetramethylpiperidin-2-yl)butanehydrazide.
| Compound Name | 2-phenyl-N,2-bis(2,4,6,6-tetramethylpiperidin-2-yl)butanehydrazide |
|---|---|
| PubChem CID | 23310914 |
| Molecular Formula | C28H48N4O |
| Molecular Weight | 456.72 g/mol |
| Exact Mass | 456.38 |
| IUPAC Name | 2-phenyl-N,2-bis(2,4,6,6-tetramethylpiperidin-2-yl)butanehydrazide |
| SMILES | CCC(C(=O)N(N)C1(C)CC(C)CC(C)(C)N1)(c1ccccc1)C1(C)CC(C)CC(C)(C)N1 |
| InChI | InChI=1S/C28H48N4O/c1-10-28(22-14-12-11-13-15-22,26(8)18-20(2)16-24(4,5)30-26)23(33)32(29)27(9)19-21(3)17-25(6,7)31-27/h11-15,20-21,30-31H,10,16-19,29H2,1-9H3 |
| InChIKey | NALPWMIXKWDWCK-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.72 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|