C11H5Cl4NO3 — CID 23332919
2,4-bis(dichloromethylidene)-1,3-benzodioxine-6-carboxamide (PubChem CID 23332919) has the molecular formula C11H5Cl4NO3 and a molecular weight of 340.98 g/mol. Its IUPAC name is 2,4-bis(dichloromethylidene)-1,3-benzodioxine-6-carboxamide.
| Compound Name | 2,4-bis(dichloromethylidene)-1,3-benzodioxine-6-carboxamide |
|---|---|
| PubChem CID | 23332919 |
| Molecular Formula | C11H5Cl4NO3 |
| Molecular Weight | 340.98 g/mol |
| Exact Mass | 338.90 |
| IUPAC Name | 2,4-bis(dichloromethylidene)-1,3-benzodioxine-6-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)C(=C(Cl)Cl)OC(=C(Cl)Cl)O2 |
| InChI | InChI=1S/C11H5Cl4NO3/c12-8(13)7-5-3-4(10(16)17)1-2-6(5)18-11(19-7)9(14)15/h1-3H,(H2,16,17) |
| InChIKey | UPUUHROFTBJWRC-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.98 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |