C10H16N6S — CID 23337134
2-cyano-1-methyl-1-[3-(1,3-thiazol-2-ylmethylamino)propyl]guanidine (PubChem CID 23337134) has the molecular formula C10H16N6S and a molecular weight of 252.35 g/mol. Its IUPAC name is 2-cyano-1-methyl-1-[3-(1,3-thiazol-2-ylmethylamino)propyl]guanidine.
| Compound Name | 2-cyano-1-methyl-1-[3-(1,3-thiazol-2-ylmethylamino)propyl]guanidine |
|---|---|
| PubChem CID | 23337134 |
| Molecular Formula | C10H16N6S |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 2-cyano-1-methyl-1-[3-(1,3-thiazol-2-ylmethylamino)propyl]guanidine |
| SMILES | CN(CCCNCc1nccs1)/C(N)=N/C#N |
| InChI | InChI=1S/C10H16N6S/c1-16(10(12)15-8-11)5-2-3-13-7-9-14-4-6-17-9/h4,6,13H,2-3,5,7H2,1H3,(H2,12,15) |
| InChIKey | ZOVZBKHMSJNLJQ-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 90.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|