C18H29N7O4 — CID 23340376
tert-butyl N-[[6-[4-[bis(2-hydroxyethyl)amino]-3,5-dimethylpyrazol-1-yl]pyridazin-3-yl]amino]carbamate (PubChem CID 23340376) has the molecular formula C18H29N7O4 and a molecular weight of 407.48 g/mol. Its IUPAC name is tert-butyl N-[[6-[4-[bis(2-hydroxyethyl)amino]-3,5-dimethylpyrazol-1-yl]pyridazin-3-yl]amino]carbamate.
| Compound Name | tert-butyl N-[[6-[4-[bis(2-hydroxyethyl)amino]-3,5-dimethylpyrazol-1-yl]pyridazin-3-yl]amino]carbamate |
|---|---|
| PubChem CID | 23340376 |
| Molecular Formula | C18H29N7O4 |
| Molecular Weight | 407.48 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | tert-butyl N-[[6-[4-[bis(2-hydroxyethyl)amino]-3,5-dimethylpyrazol-1-yl]pyridazin-3-yl]amino]carbamate |
| SMILES | Cc1nn(-c2ccc(NNC(=O)OC(C)(C)C)nn2)c(C)c1N(CCO)CCO |
| InChI | InChI=1S/C18H29N7O4/c1-12-16(24(8-10-26)9-11-27)13(2)25(23-12)15-7-6-14(19-21-15)20-22-17(28)29-18(3,4)5/h6-7,26-27H,8-11H2,1-5H3,(H,19,20)(H,22,28) |
| InChIKey | ITWDZFBMFPSEKQ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 137.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.48 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|