C11H8Cl2N4O4 — CID 23354062
3-acetyl-6,7-dichloro-5-nitro-1,4-dihydroquinoxaline-2-carboxamide (PubChem CID 23354062) has the molecular formula C11H8Cl2N4O4 and a molecular weight of 331.12 g/mol. Its IUPAC name is 3-acetyl-6,7-dichloro-5-nitro-1,4-dihydroquinoxaline-2-carboxamide.
| Compound Name | 3-acetyl-6,7-dichloro-5-nitro-1,4-dihydroquinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 23354062 |
| Molecular Formula | C11H8Cl2N4O4 |
| Molecular Weight | 331.12 g/mol |
| Exact Mass | 329.99 |
| IUPAC Name | 3-acetyl-6,7-dichloro-5-nitro-1,4-dihydroquinoxaline-2-carboxamide |
| SMILES | CC(=O)C1=C(C(N)=O)Nc2cc(Cl)c(Cl)c([N+](=O)[O-])c2N1 |
| InChI | InChI=1S/C11H8Cl2N4O4/c1-3(18)7-9(11(14)19)15-5-2-4(12)6(13)10(17(20)21)8(5)16-7/h2,15-16H,1H3,(H2,14,19) |
| InChIKey | CYQNXVGVVJHFRW-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.12 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|