About bis(1-adamantylmethyl) 4,6-dinitro-5-(trioxidanylsulfanyl)benzene-1,3-dicarboxylate
bis(1-adamantylmethyl) 4,6-dinitro-5-(trioxidanylsulfanyl)benzene-1,3-dicarboxylate (PubChem CID 23393607) has the molecular formula C30H36N2O11S
and a molecular weight of 632.69 g/mol. Its IUPAC name is bis(1-adamantylmethyl) 4,6-dinitro-5-(trioxidanylsulfanyl)benzene-1,3-dicarboxylate.
Molecular Properties
| Compound Name | bis(1-adamantylmethyl) 4,6-dinitro-5-(trioxidanylsulfanyl)benzene-1,3-dicarboxylate |
| PubChem CID | 23393607 |
| Molecular Formula | C30H36N2O11S |
| Molecular Weight | 632.69 g/mol |
| Exact Mass | 632.20 |
| IUPAC Name | bis(1-adamantylmethyl) 4,6-dinitro-5-(trioxidanylsulfanyl)benzene-1,3-dicarboxylate |
| SMILES | O=C(OCC12CC3CC(CC(C3)C1)C2)c1cc(C(=O)OCC23CC4CC(CC(C4)C2)C3)c([N+](=O)[O-])c(SOOO)c1[N+](=O)[O-] |
| InChI | InChI=1S/C30H36N2O11S/c33-27(40-14-29-8-16-1-17(9-29)3-18(2-16)10-29)22-7-23(25(32(37)38)26(44-43-42-39)24(22)31(35)36)28(34)41-15-30-11-19-4-20(12-30)6-21(5-19)13-30/h7,16-21,39H,1-6,8-15H2 |
| InChIKey | ABDUSJXGNLQXCT-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 177.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 632.69 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze bis(1-adamantylmethyl) 4,6-dinitro-5-(trioxidanylsulfanyl)benzene-1,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1-adamantylmethyl) 4,6-dinitro-5-(trioxidanylsulfanyl)benzene-1,3-dicarboxylate?
The IUPAC name of bis(1-adamantylmethyl) 4,6-dinitro-5-(trioxidanylsulfanyl)benzene-1,3-dicarboxylate (CID 23393607) is bis(1-adamantylmethyl) 4,6-dinitro-5-(trioxidanylsulfanyl)benzene-1,3-dicarboxylate.
What is the SMILES notation for bis(1-adamantylmethyl) 4,6-dinitro-5-(trioxidanylsulfanyl)benzene-1,3-dicarboxylate?
The canonical SMILES for bis(1-adamantylmethyl) 4,6-dinitro-5-(trioxidanylsulfanyl)benzene-1,3-dicarboxylate is O=C(OCC12CC3CC(CC(C3)C1)C2)c1cc(C(=O)OCC23CC4CC(CC(C4)C2)C3)c([N+](=O)[O-])c(SOOO)c1[N+](=O)[O-].
What is the InChIKey of bis(1-adamantylmethyl) 4,6-dinitro-5-(trioxidanylsulfanyl)benzene-1,3-dicarboxylate?
The InChIKey is ABDUSJXGNLQXCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H36N2O11S/c33-27(40-14-29-8-16-1-17(9-29)3-18(2-16)10-29)22-7-23(25(32(37)38)26(44-43-42-39)24(22)31(35)36)28(34)41-15-30-11-19-4-20(12-30)6-21(5-19)13-30/h7,16-21,39H,1-6,8-15H2.
What are the key properties of bis(1-adamantylmethyl) 4,6-dinitro-5-(trioxidanylsulfanyl)benzene-1,3-dicarboxylate?
bis(1-adamantylmethyl) 4,6-dinitro-5-(trioxidanylsulfanyl)benzene-1,3-dicarboxylate has a molecular weight of 632.69 g/mol, XLogP of 6.68, 11 rotatable bonds, 1 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1-adamantylmethyl) 4,6-dinitro-5-(trioxidanylsulfanyl)benzene-1,3-dicarboxylate is sourced from PubChem (CID 23393607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).