C20H20BF4NO — CID 23411858
cyclopentyl-(2-phenylchromen-4-ylidene)azanium tetrafluoroborate (PubChem CID 23411858) has the molecular formula C20H20BF4NO and a molecular weight of 377.19 g/mol. Its IUPAC name is cyclopentyl-(2-phenylchromen-4-ylidene)azanium tetrafluoroborate.
| Compound Name | cyclopentyl-(2-phenylchromen-4-ylidene)azanium tetrafluoroborate |
|---|---|
| PubChem CID | 23411858 |
| Molecular Formula | C20H20BF4NO |
| Molecular Weight | 377.19 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | cyclopentyl-(2-phenylchromen-4-ylidene)azanium tetrafluoroborate |
| SMILES | F[B-](F)(F)F.c1ccc(-c2c/c(=[NH+]\C3CCCC3)c3ccccc3o2)cc1 |
| InChI | InChI=1S/C20H19NO.BF4/c1-2-8-15(9-3-1)20-14-18(21-16-10-4-5-11-16)17-12-6-7-13-19(17)22-20;2-1(3,4)5/h1-3,6-9,12-14,16H,4-5,10-11H2;/q;-1/p+1/b21-18+; |
| InChIKey | DAEFGKCBCILDEZ-GOSREXKOSA-O |
| XLogP | 4.32 |
| TPSA | 27.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.19 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|