C14H24AsO7P — CID 23412694
2-[diethoxyphosphoryl(furan-2-yl)methoxy]-5,5-dimethyl-1,3,2-dioxarsinane (PubChem CID 23412694) has the molecular formula C14H24AsO7P and a molecular weight of 410.24 g/mol. Its IUPAC name is 2-[diethoxyphosphoryl(furan-2-yl)methoxy]-5,5-dimethyl-1,3,2-dioxarsinane.
| Compound Name | 2-[diethoxyphosphoryl(furan-2-yl)methoxy]-5,5-dimethyl-1,3,2-dioxarsinane |
|---|---|
| PubChem CID | 23412694 |
| Molecular Formula | C14H24AsO7P |
| Molecular Weight | 410.24 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | 2-[diethoxyphosphoryl(furan-2-yl)methoxy]-5,5-dimethyl-1,3,2-dioxarsinane |
| SMILES | CCOP(=O)(OCC)C(O[As]1OCC(C)(C)CO1)c1ccco1 |
| InChI | InChI=1S/C14H24AsO7P/c1-5-20-23(16,21-6-2)13(12-8-7-9-17-12)22-15-18-10-14(3,4)11-19-15/h7-9,13H,5-6,10-11H2,1-4H3 |
| InChIKey | RQHWKQDKHCCWPL-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 76.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.24 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|