C16H25BClO6P — CID 23412667
2-[(2-chlorophenyl)-diethoxyphosphorylmethoxy]-5,5-dimethyl-1,3,2-dioxaborinane (PubChem CID 23412667) has the molecular formula C16H25BClO6P and a molecular weight of 390.61 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)-diethoxyphosphorylmethoxy]-5,5-dimethyl-1,3,2-dioxaborinane.
| Compound Name | 2-[(2-chlorophenyl)-diethoxyphosphorylmethoxy]-5,5-dimethyl-1,3,2-dioxaborinane |
|---|---|
| PubChem CID | 23412667 |
| Molecular Formula | C16H25BClO6P |
| Molecular Weight | 390.61 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 2-[(2-chlorophenyl)-diethoxyphosphorylmethoxy]-5,5-dimethyl-1,3,2-dioxaborinane |
| SMILES | CCOP(=O)(OCC)C(OB1OCC(C)(C)CO1)c1ccccc1Cl |
| InChI | InChI=1S/C16H25BClO6P/c1-5-22-25(19,23-6-2)15(13-9-7-8-10-14(13)18)24-17-20-11-16(3,4)12-21-17/h7-10,15H,5-6,11-12H2,1-4H3 |
| InChIKey | XCKVSHNAFNVWAM-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.61 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|