C20H21OP — CID 23419045
(1S,3aS,6aS)-3-methyl-1,2-diphenyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]phosphole 1-oxide (PubChem CID 23419045) has the molecular formula C20H21OP and a molecular weight of 308.36 g/mol. Its IUPAC name is (1S,3aS,6aS)-3-methyl-1,2-diphenyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]phosphole 1-oxide.
| Compound Name | (1S,3aS,6aS)-3-methyl-1,2-diphenyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]phosphole 1-oxide |
|---|---|
| PubChem CID | 23419045 |
| Molecular Formula | C20H21OP |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | (1S,3aS,6aS)-3-methyl-1,2-diphenyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]phosphole 1-oxide |
| SMILES | CC1=C(c2ccccc2)[P@@](=O)(c2ccccc2)[C@H]2CCC[C@@H]12 |
| InChI | InChI=1S/C20H21OP/c1-15-18-13-8-14-19(18)22(21,17-11-6-3-7-12-17)20(15)16-9-4-2-5-10-16/h2-7,9-12,18-19H,8,13-14H2,1H3/t18-,19-,22+/m0/s1 |
| InChIKey | GPZJWWOVVIIMJX-CNNODRBYSA-N |
| XLogP | 5.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|