C8H11N — CID 23423519
4-deuterio-2,6-dimethylaniline (PubChem CID 23423519) has the molecular formula C8H11N and a molecular weight of 122.19 g/mol. Its IUPAC name is 4-deuterio-2,6-dimethylaniline.
| Compound Name | 4-deuterio-2,6-dimethylaniline |
|---|---|
| PubChem CID | 23423519 |
| Molecular Formula | C8H11N |
| Molecular Weight | 122.19 g/mol |
| Exact Mass | 122.10 |
| IUPAC Name | 4-deuterio-2,6-dimethylaniline |
| SMILES | [2H]c1cc(C)c(N)c(C)c1 |
| InChI | InChI=1S/C8H11N/c1-6-4-3-5-7(2)8(6)9/h3-5H,9H2,1-2H3/i3D |
| InChIKey | UFFBMTHBGFGIHF-WFVSFCRTSA-N |
| XLogP | 1.89 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.19 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|