C25H18Cl2N3O3PS — CID 2343962
N-bis[(Z)-2-chloro-2-phenylethenyl]phosphoryl-4-(3-nitrophenyl)-1,3-thiazol-2-amine (PubChem CID 2343962) has the molecular formula C25H18Cl2N3O3PS and a molecular weight of 542.38 g/mol. Its IUPAC name is N-bis[(Z)-2-chloro-2-phenylethenyl]phosphoryl-4-(3-nitrophenyl)-1,3-thiazol-2-amine.
| Compound Name | N-bis[(Z)-2-chloro-2-phenylethenyl]phosphoryl-4-(3-nitrophenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 2343962 |
| Molecular Formula | C25H18Cl2N3O3PS |
| Molecular Weight | 542.38 g/mol |
| Exact Mass | 541.02 |
| IUPAC Name | N-bis[(Z)-2-chloro-2-phenylethenyl]phosphoryl-4-(3-nitrophenyl)-1,3-thiazol-2-amine |
| SMILES | O=[N+]([O-])c1cccc(-c2csc(NP(=O)(/C=C(\Cl)c3ccccc3)/C=C(\Cl)c3ccccc3)n2)c1 |
| InChI | InChI=1S/C25H18Cl2N3O3PS/c26-22(18-8-3-1-4-9-18)15-34(33,16-23(27)19-10-5-2-6-11-19)29-25-28-24(17-35-25)20-12-7-13-21(14-20)30(31)32/h1-17H,(H,28,29,33)/b22-15-,23-16- |
| InChIKey | ASHJIQWIEXLXKS-OZKZUFLSSA-N |
| XLogP | 8.88 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.38 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|