C5H8N2O3S — CID 23442814
4,5-dimethyl-3-(sulfinoamino)-1,2-oxazole (PubChem CID 23442814) has the molecular formula C5H8N2O3S and a molecular weight of 176.20 g/mol. Its IUPAC name is 4,5-dimethyl-3-(sulfinoamino)-1,2-oxazole.
| Compound Name | 4,5-dimethyl-3-(sulfinoamino)-1,2-oxazole |
|---|---|
| PubChem CID | 23442814 |
| Molecular Formula | C5H8N2O3S |
| Molecular Weight | 176.20 g/mol |
| Exact Mass | 176.03 |
| IUPAC Name | 4,5-dimethyl-3-(sulfinoamino)-1,2-oxazole |
| SMILES | Cc1onc(NS(=O)O)c1C |
| InChI | InChI=1S/C5H8N2O3S/c1-3-4(2)10-6-5(3)7-11(8)9/h1-2H3,(H,6,7)(H,8,9) |
| InChIKey | NARBFKGKYHQXMD-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.20 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|