C6H7F2N3O2 — CID 23454344
2,4-difluoro-6-(1-methoxyethoxy)-1,3,5-triazine (PubChem CID 23454344) has the molecular formula C6H7F2N3O2 and a molecular weight of 191.14 g/mol. Its IUPAC name is 2,4-difluoro-6-(1-methoxyethoxy)-1,3,5-triazine.
| Compound Name | 2,4-difluoro-6-(1-methoxyethoxy)-1,3,5-triazine |
|---|---|
| PubChem CID | 23454344 |
| Molecular Formula | C6H7F2N3O2 |
| Molecular Weight | 191.14 g/mol |
| Exact Mass | 191.05 |
| IUPAC Name | 2,4-difluoro-6-(1-methoxyethoxy)-1,3,5-triazine |
| SMILES | COC(C)Oc1nc(F)nc(F)n1 |
| InChI | InChI=1S/C6H7F2N3O2/c1-3(12-2)13-6-10-4(7)9-5(8)11-6/h3H,1-2H3 |
| InChIKey | FVUJURBGZWPMGG-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.14 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|