C20H27ClN3O2S+ — CID 2346026
N-[1-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]-2-methylpropan-2-yl]benzenesulfonamide (PubChem CID 2346026) has the molecular formula C20H27ClN3O2S+ and a molecular weight of 408.98 g/mol. Its IUPAC name is N-[1-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]-2-methylpropan-2-yl]benzenesulfonamide.
| Compound Name | N-[1-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]-2-methylpropan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 2346026 |
| Molecular Formula | C20H27ClN3O2S+ |
| Molecular Weight | 408.98 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | N-[1-[4-(3-chlorophenyl)piperazin-1-ium-1-yl]-2-methylpropan-2-yl]benzenesulfonamide |
| SMILES | CC(C)(C[NH+]1CCN(c2cccc(Cl)c2)CC1)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H26ClN3O2S/c1-20(2,22-27(25,26)19-9-4-3-5-10-19)16-23-11-13-24(14-12-23)18-8-6-7-17(21)15-18/h3-10,15,22H,11-14,16H2,1-2H3/p+1 |
| InChIKey | HFECHKCRDJJTKN-UHFFFAOYSA-O |
| XLogP | 1.80 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.98 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |