C16H19N3O3 — CID 23467529
2-(4-amino-2,5-dimethylanilino)-5-(2-hydroxyethylamino)cyclohexa-2,5-diene-1,4-dione (PubChem CID 23467529) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is 2-(4-amino-2,5-dimethylanilino)-5-(2-hydroxyethylamino)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-(4-amino-2,5-dimethylanilino)-5-(2-hydroxyethylamino)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 23467529 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 2-(4-amino-2,5-dimethylanilino)-5-(2-hydroxyethylamino)cyclohexa-2,5-diene-1,4-dione |
| SMILES | Cc1cc(NC2=CC(=O)C(NCCO)=CC2=O)c(C)cc1N |
| InChI | InChI=1S/C16H19N3O3/c1-9-6-12(10(2)5-11(9)17)19-14-8-15(21)13(7-16(14)22)18-3-4-20/h5-8,18-20H,3-4,17H2,1-2H3 |
| InChIKey | MKBPRPVVABTKGK-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|