C16H11Br2N3O3 — CID 23474637
N-(2,4-dibromophenyl)-N-methyl-2,3-dioxo-1,4-dihydroquinoxaline-6-carboxamide (PubChem CID 23474637) has the molecular formula C16H11Br2N3O3 and a molecular weight of 453.09 g/mol. Its IUPAC name is N-(2,4-dibromophenyl)-N-methyl-2,3-dioxo-1,4-dihydroquinoxaline-6-carboxamide.
| Compound Name | N-(2,4-dibromophenyl)-N-methyl-2,3-dioxo-1,4-dihydroquinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 23474637 |
| Molecular Formula | C16H11Br2N3O3 |
| Molecular Weight | 453.09 g/mol |
| Exact Mass | 450.92 |
| IUPAC Name | N-(2,4-dibromophenyl)-N-methyl-2,3-dioxo-1,4-dihydroquinoxaline-6-carboxamide |
| SMILES | CN(C(=O)c1ccc2[nH]c(=O)c(=O)[nH]c2c1)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C16H11Br2N3O3/c1-21(13-5-3-9(17)7-10(13)18)16(24)8-2-4-11-12(6-8)20-15(23)14(22)19-11/h2-7H,1H3,(H,19,22)(H,20,23) |
| InChIKey | BZXABPJZWPXDJR-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 86.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.09 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|