C32H26N4O2S — CID 2347655
(E)-3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]-N-[4-(2,4,6-trimethylphenyl)-1,3-thiazol-2-yl]prop-2-enamide (PubChem CID 2347655) has the molecular formula C32H26N4O2S and a molecular weight of 530.65 g/mol. Its IUPAC name is (E)-3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]-N-[4-(2,4,6-trimethylphenyl)-1,3-thiazol-2-yl]prop-2-enamide.
| Compound Name | (E)-3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]-N-[4-(2,4,6-trimethylphenyl)-1,3-thiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 2347655 |
| Molecular Formula | C32H26N4O2S |
| Molecular Weight | 530.65 g/mol |
| Exact Mass | 530.18 |
| IUPAC Name | (E)-3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]-N-[4-(2,4,6-trimethylphenyl)-1,3-thiazol-2-yl]prop-2-enamide |
| SMILES | Cc1cc(C)c(-c2csc(NC(=O)/C=C/c3cn(-c4ccccc4)nc3-c3cc4ccccc4o3)n2)c(C)c1 |
| InChI | InChI=1S/C32H26N4O2S/c1-20-15-21(2)30(22(3)16-20)26-19-39-32(33-26)34-29(37)14-13-24-18-36(25-10-5-4-6-11-25)35-31(24)28-17-23-9-7-8-12-27(23)38-28/h4-19H,1-3H3,(H,33,34,37)/b14-13+ |
| InChIKey | CJXDLSXBVWMNNP-BUHFOSPRSA-N |
| XLogP | 7.99 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.65 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|