C16H12ClN5O4 — CID 2348273
(2S)-2-(1,3-benzoxazol-2-yl)-2-(5-chloro-3-nitro-6-oxo-1-propylpyridazin-4-yl)acetonitrile (PubChem CID 2348273) has the molecular formula C16H12ClN5O4 and a molecular weight of 373.76 g/mol. Its IUPAC name is (2S)-2-(1,3-benzoxazol-2-yl)-2-(5-chloro-3-nitro-6-oxo-1-propylpyridazin-4-yl)acetonitrile.
| Compound Name | (2S)-2-(1,3-benzoxazol-2-yl)-2-(5-chloro-3-nitro-6-oxo-1-propylpyridazin-4-yl)acetonitrile |
|---|---|
| PubChem CID | 2348273 |
| Molecular Formula | C16H12ClN5O4 |
| Molecular Weight | 373.76 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | (2S)-2-(1,3-benzoxazol-2-yl)-2-(5-chloro-3-nitro-6-oxo-1-propylpyridazin-4-yl)acetonitrile |
| SMILES | CCCn1nc([N+](=O)[O-])c([C@@H](C#N)c2nc3ccccc3o2)c(Cl)c1=O |
| InChI | InChI=1S/C16H12ClN5O4/c1-2-7-21-16(23)13(17)12(14(20-21)22(24)25)9(8-18)15-19-10-5-3-4-6-11(10)26-15/h3-6,9H,2,7H2,1H3/t9-/m1/s1 |
| InChIKey | VACUYCLHGKPLFP-SECBINFHSA-N |
| XLogP | 3.01 |
| TPSA | 127.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.76 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|