C6HF9O — CID 23498218
(Z)-2,3,3,4,4,4-hexafluoro-1-(1,2,2-trifluoroethenoxy)but-1-ene (PubChem CID 23498218) has the molecular formula C6HF9O and a molecular weight of 260.06 g/mol. Its IUPAC name is (Z)-2,3,3,4,4,4-hexafluoro-1-(1,2,2-trifluoroethenoxy)but-1-ene.
| Compound Name | (Z)-2,3,3,4,4,4-hexafluoro-1-(1,2,2-trifluoroethenoxy)but-1-ene |
|---|---|
| PubChem CID | 23498218 |
| Molecular Formula | C6HF9O |
| Molecular Weight | 260.06 g/mol |
| Exact Mass | 259.99 |
| IUPAC Name | (Z)-2,3,3,4,4,4-hexafluoro-1-(1,2,2-trifluoroethenoxy)but-1-ene |
| SMILES | FC(F)=C(F)O/C=C(\F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6HF9O/c7-2(1-16-4(10)3(8)9)5(11,12)6(13,14)15/h1H/b2-1- |
| InChIKey | NAPLSVHZRADTSP-UPHRSURJSA-N |
| XLogP | 4.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.06 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|