About 1'-(1-methoxypropyl)spiro[1H-indole-3,3'-piperidine]-2-one;hydrochloride
1'-(1-methoxypropyl)spiro[1H-indole-3,3'-piperidine]-2-one;hydrochloride (PubChem CID 23500751) has the molecular formula C16H23ClN2O2
and a molecular weight of 310.82 g/mol. Its IUPAC name is 1'-(1-methoxypropyl)spiro[1H-indole-3,3'-piperidine]-2-one;hydrochloride.
Molecular Properties
| Compound Name | 1'-(1-methoxypropyl)spiro[1H-indole-3,3'-piperidine]-2-one;hydrochloride |
| PubChem CID | 23500751 |
| Molecular Formula | C16H23ClN2O2 |
| Molecular Weight | 310.82 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 1'-(1-methoxypropyl)spiro[1H-indole-3,3'-piperidine]-2-one;hydrochloride |
| SMILES | CCC(OC)N1CCCC2(C1)C(=O)Nc1ccccc12.Cl |
| InChI | InChI=1S/C16H22N2O2.ClH/c1-3-14(20-2)18-10-6-9-16(11-18)12-7-4-5-8-13(12)17-15(16)19;/h4-5,7-8,14H,3,6,9-11H2,1-2H3,(H,17,19);1H |
| InChIKey | KUBCQTOFPMPFHC-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.82 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1'-(1-methoxypropyl)spiro[1H-indole-3,3'-piperidine]-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-(1-methoxypropyl)spiro[1H-indole-3,3'-piperidine]-2-one;hydrochloride?
The IUPAC name of 1'-(1-methoxypropyl)spiro[1H-indole-3,3'-piperidine]-2-one;hydrochloride (CID 23500751) is 1'-(1-methoxypropyl)spiro[1H-indole-3,3'-piperidine]-2-one;hydrochloride.
What is the SMILES notation for 1'-(1-methoxypropyl)spiro[1H-indole-3,3'-piperidine]-2-one;hydrochloride?
The canonical SMILES for 1'-(1-methoxypropyl)spiro[1H-indole-3,3'-piperidine]-2-one;hydrochloride is CCC(OC)N1CCCC2(C1)C(=O)Nc1ccccc12.Cl.
What is the InChIKey of 1'-(1-methoxypropyl)spiro[1H-indole-3,3'-piperidine]-2-one;hydrochloride?
The InChIKey is KUBCQTOFPMPFHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N2O2.ClH/c1-3-14(20-2)18-10-6-9-16(11-18)12-7-4-5-8-13(12)17-15(16)19;/h4-5,7-8,14H,3,6,9-11H2,1-2H3,(H,17,19);1H.
What are the key properties of 1'-(1-methoxypropyl)spiro[1H-indole-3,3'-piperidine]-2-one;hydrochloride?
1'-(1-methoxypropyl)spiro[1H-indole-3,3'-piperidine]-2-one;hydrochloride has a molecular weight of 310.82 g/mol, XLogP of 2.78, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-(1-methoxypropyl)spiro[1H-indole-3,3'-piperidine]-2-one;hydrochloride is sourced from PubChem (CID 23500751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).