C7H17N2P3 — CID 23532227
phosphanyl-(6-phosphanyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl)phosphane (PubChem CID 23532227) has the molecular formula C7H17N2P3 and a molecular weight of 222.15 g/mol. Its IUPAC name is phosphanyl-(6-phosphanyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl)phosphane.
| Compound Name | phosphanyl-(6-phosphanyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl)phosphane |
|---|---|
| PubChem CID | 23532227 |
| Molecular Formula | C7H17N2P3 |
| Molecular Weight | 222.15 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | phosphanyl-(6-phosphanyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl)phosphane |
| SMILES | PPN1CCCC2CN(P)CC21 |
| InChI | InChI=1S/C7H17N2P3/c10-8-4-6-2-1-3-9(12-11)7(6)5-8/h6-7,12H,1-5,10-11H2 |
| InChIKey | JKXJHBFVXWXVJK-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.15 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|