C14H10N4O2S — CID 23536702
N-(1,3-benzodioxol-5-yl)-4-thiophen-2-yl-1,3,5-triazin-2-amine (PubChem CID 23536702) has the molecular formula C14H10N4O2S and a molecular weight of 298.33 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-4-thiophen-2-yl-1,3,5-triazin-2-amine.
| Compound Name | N-(1,3-benzodioxol-5-yl)-4-thiophen-2-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 23536702 |
| Molecular Formula | C14H10N4O2S |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-4-thiophen-2-yl-1,3,5-triazin-2-amine |
| SMILES | c1csc(-c2ncnc(Nc3ccc4c(c3)OCO4)n2)c1 |
| InChI | InChI=1S/C14H10N4O2S/c1-2-12(21-5-1)13-15-7-16-14(18-13)17-9-3-4-10-11(6-9)20-8-19-10/h1-7H,8H2,(H,15,16,17,18) |
| InChIKey | LERZJNDUFZRGOR-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |