C43H28ClFN6O — CID 23537660
5-(4-chloro-2-fluorophenyl)-3-[4-[6-(1-tritylpyrazol-4-yl)imidazo[1,2-a]pyridin-3-yl]phenyl]-1,2,4-oxadiazole (PubChem CID 23537660) has the molecular formula C43H28ClFN6O and a molecular weight of 699.19 g/mol. Its IUPAC name is 5-(4-chloro-2-fluorophenyl)-3-[4-[6-(1-tritylpyrazol-4-yl)imidazo[1,2-a]pyridin-3-yl]phenyl]-1,2,4-oxadiazole.
| Compound Name | 5-(4-chloro-2-fluorophenyl)-3-[4-[6-(1-tritylpyrazol-4-yl)imidazo[1,2-a]pyridin-3-yl]phenyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 23537660 |
| Molecular Formula | C43H28ClFN6O |
| Molecular Weight | 699.19 g/mol |
| Exact Mass | 698.20 |
| IUPAC Name | 5-(4-chloro-2-fluorophenyl)-3-[4-[6-(1-tritylpyrazol-4-yl)imidazo[1,2-a]pyridin-3-yl]phenyl]-1,2,4-oxadiazole |
| SMILES | Fc1cc(Cl)ccc1-c1nc(-c2ccc(-c3cnc4ccc(-c5cnn(C(c6ccccc6)(c6ccccc6)c6ccccc6)c5)cn34)cc2)no1 |
| InChI | InChI=1S/C43H28ClFN6O/c44-36-21-22-37(38(45)24-36)42-48-41(49-52-42)30-18-16-29(17-19-30)39-26-46-40-23-20-31(27-50(39)40)32-25-47-51(28-32)43(33-10-4-1-5-11-33,34-12-6-2-7-13-34)35-14-8-3-9-15-35/h1-28H |
| InChIKey | PNWHZPJVSDAAID-UHFFFAOYSA-N |
| XLogP | 10.21 |
| TPSA | 74.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.19 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|