C9H11O5Y+2 — CID 23538079
2-[1-hydroxy-2-(oxomethoxy)ethyl]-3,4-dimethyl-2H-furan-5-one;yttrium(3+) (PubChem CID 23538079) has the molecular formula C9H11O5Y+2 and a molecular weight of 288.09 g/mol. Its IUPAC name is 2-[1-hydroxy-2-(oxomethoxy)ethyl]-3,4-dimethyl-2H-furan-5-one;yttrium(3+).
| Compound Name | 2-[1-hydroxy-2-(oxomethoxy)ethyl]-3,4-dimethyl-2H-furan-5-one;yttrium(3+) |
|---|---|
| PubChem CID | 23538079 |
| Molecular Formula | C9H11O5Y+2 |
| Molecular Weight | 288.09 g/mol |
| Exact Mass | 287.97 |
| IUPAC Name | 2-[1-hydroxy-2-(oxomethoxy)ethyl]-3,4-dimethyl-2H-furan-5-one;yttrium(3+) |
| SMILES | CC1=C(C)C(C(O)CO[C-]=O)OC1=O.[Y+3] |
| InChI | InChI=1S/C9H11O5.Y/c1-5-6(2)9(12)14-8(5)7(11)3-13-4-10;/h7-8,11H,3H2,1-2H3;/q-1;+3 |
| InChIKey | IRCDFXHJZHFDOQ-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.09 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|