C10H14O6 — CID 90305836
(5R)-5-[(1S)-1-hydroxy-2-[(2-methylpropan-2-yl)oxy]ethyl]oxolane-2,3,4-trione (PubChem CID 90305836) has the molecular formula C10H14O6 and a molecular weight of 230.22 g/mol. Its IUPAC name is (5R)-5-[(1S)-1-hydroxy-2-[(2-methylpropan-2-yl)oxy]ethyl]oxolane-2,3,4-trione.
| Compound Name | (5R)-5-[(1S)-1-hydroxy-2-[(2-methylpropan-2-yl)oxy]ethyl]oxolane-2,3,4-trione |
|---|---|
| PubChem CID | 90305836 |
| Molecular Formula | C10H14O6 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | (5R)-5-[(1S)-1-hydroxy-2-[(2-methylpropan-2-yl)oxy]ethyl]oxolane-2,3,4-trione |
| SMILES | CC(C)(C)OC[C@H](O)[C@H]1OC(=O)C(=O)C1=O |
| InChI | InChI=1S/C10H14O6/c1-10(2,3)15-4-5(11)8-6(12)7(13)9(14)16-8/h5,8,11H,4H2,1-3H3/t5-,8+/m0/s1 |
| InChIKey | IZQIDRUQTAAFJT-YLWLKBPMSA-N |
| XLogP | -0.77 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|