C9H12O5 — CID 23538080
[2-(3,4-dimethyl-5-oxo-2H-furan-2-yl)-2-hydroxyethyl] formate (PubChem CID 23538080) has the molecular formula C9H12O5 and a molecular weight of 200.19 g/mol. Its IUPAC name is [2-(3,4-dimethyl-5-oxo-2H-furan-2-yl)-2-hydroxyethyl] formate.
| Compound Name | [2-(3,4-dimethyl-5-oxo-2H-furan-2-yl)-2-hydroxyethyl] formate |
|---|---|
| PubChem CID | 23538080 |
| Molecular Formula | C9H12O5 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | [2-(3,4-dimethyl-5-oxo-2H-furan-2-yl)-2-hydroxyethyl] formate |
| SMILES | CC1=C(C)C(C(O)COC=O)OC1=O |
| InChI | InChI=1S/C9H12O5/c1-5-6(2)9(12)14-8(5)7(11)3-13-4-10/h4,7-8,11H,3H2,1-2H3 |
| InChIKey | JACLTFPPEKSBIX-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|