About [2-(3,4-dimethyl-5-oxo-2H-furan-2-yl)-2-hydroxyethyl] formate
[2-(3,4-dimethyl-5-oxo-2H-furan-2-yl)-2-hydroxyethyl] formate (PubChem CID 23538080) has the molecular formula C9H12O5
and a molecular weight of 200.19 g/mol. Its IUPAC name is [2-(3,4-dimethyl-5-oxo-2H-furan-2-yl)-2-hydroxyethyl] formate.
Molecular Properties
| Compound Name | [2-(3,4-dimethyl-5-oxo-2H-furan-2-yl)-2-hydroxyethyl] formate |
| PubChem CID | 23538080 |
| Molecular Formula | C9H12O5 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | [2-(3,4-dimethyl-5-oxo-2H-furan-2-yl)-2-hydroxyethyl] formate |
| SMILES | CC1=C(C)C(C(O)COC=O)OC1=O |
| InChI | InChI=1S/C9H12O5/c1-5-6(2)9(12)14-8(5)7(11)3-13-4-10/h4,7-8,11H,3H2,1-2H3 |
| InChIKey | JACLTFPPEKSBIX-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze [2-(3,4-dimethyl-5-oxo-2H-furan-2-yl)-2-hydroxyethyl] formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3,4-dimethyl-5-oxo-2H-furan-2-yl)-2-hydroxyethyl] formate?
The IUPAC name of [2-(3,4-dimethyl-5-oxo-2H-furan-2-yl)-2-hydroxyethyl] formate (CID 23538080) is [2-(3,4-dimethyl-5-oxo-2H-furan-2-yl)-2-hydroxyethyl] formate.
What is the SMILES notation for [2-(3,4-dimethyl-5-oxo-2H-furan-2-yl)-2-hydroxyethyl] formate?
The canonical SMILES for [2-(3,4-dimethyl-5-oxo-2H-furan-2-yl)-2-hydroxyethyl] formate is CC1=C(C)C(C(O)COC=O)OC1=O.
What is the InChIKey of [2-(3,4-dimethyl-5-oxo-2H-furan-2-yl)-2-hydroxyethyl] formate?
The InChIKey is JACLTFPPEKSBIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O5/c1-5-6(2)9(12)14-8(5)7(11)3-13-4-10/h4,7-8,11H,3H2,1-2H3.
What are the key properties of [2-(3,4-dimethyl-5-oxo-2H-furan-2-yl)-2-hydroxyethyl] formate?
[2-(3,4-dimethyl-5-oxo-2H-furan-2-yl)-2-hydroxyethyl] formate has a molecular weight of 200.19 g/mol, XLogP of -0.22, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3,4-dimethyl-5-oxo-2H-furan-2-yl)-2-hydroxyethyl] formate is sourced from PubChem (CID 23538080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).