C13H26O5Si2 — CID 59470607
2-(1-hydroxy-2-trimethylsilyloxyethyl)-4-methyl-3-trimethylsilyloxy-2H-furan-5-one (PubChem CID 59470607) has the molecular formula C13H26O5Si2 and a molecular weight of 318.52 g/mol. Its IUPAC name is 2-(1-hydroxy-2-trimethylsilyloxyethyl)-4-methyl-3-trimethylsilyloxy-2H-furan-5-one.
| Compound Name | 2-(1-hydroxy-2-trimethylsilyloxyethyl)-4-methyl-3-trimethylsilyloxy-2H-furan-5-one |
|---|---|
| PubChem CID | 59470607 |
| Molecular Formula | C13H26O5Si2 |
| Molecular Weight | 318.52 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | 2-(1-hydroxy-2-trimethylsilyloxyethyl)-4-methyl-3-trimethylsilyloxy-2H-furan-5-one |
| SMILES | CC1=C(O[Si](C)(C)C)C(C(O)CO[Si](C)(C)C)OC1=O |
| InChI | InChI=1S/C13H26O5Si2/c1-9-11(18-20(5,6)7)12(17-13(9)15)10(14)8-16-19(2,3)4/h10,12,14H,8H2,1-7H3 |
| InChIKey | LORXIRQNUFBDNT-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.52 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|