C16H20BrN3O — CID 2354541
1-[[(E)-2-bromo-3-phenylprop-2-enylidene]amino]-3-cyclohexylurea (PubChem CID 2354541) has the molecular formula C16H20BrN3O and a molecular weight of 350.26 g/mol. Its IUPAC name is 1-[[(E)-2-bromo-3-phenylprop-2-enylidene]amino]-3-cyclohexylurea.
| Compound Name | 1-[[(E)-2-bromo-3-phenylprop-2-enylidene]amino]-3-cyclohexylurea |
|---|---|
| PubChem CID | 2354541 |
| Molecular Formula | C16H20BrN3O |
| Molecular Weight | 350.26 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | 1-[[(E)-2-bromo-3-phenylprop-2-enylidene]amino]-3-cyclohexylurea |
| SMILES | O=C(NN=C/C(Br)=C\c1ccccc1)NC1CCCCC1 |
| InChI | InChI=1S/C16H20BrN3O/c17-14(11-13-7-3-1-4-8-13)12-18-20-16(21)19-15-9-5-2-6-10-15/h1,3-4,7-8,11-12,15H,2,5-6,9-10H2,(H2,19,20,21)/b14-11+,18-12? |
| InChIKey | XKHDFIMXKSAKST-LIVPTCIVSA-N |
| XLogP | 4.04 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.26 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|