C27H21N3O5S4 — CID 2354546
N-(2-phenylphenyl)-3,5-bis(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 2354546) has the molecular formula C27H21N3O5S4 and a molecular weight of 595.75 g/mol. Its IUPAC name is N-(2-phenylphenyl)-3,5-bis(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-(2-phenylphenyl)-3,5-bis(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 2354546 |
| Molecular Formula | C27H21N3O5S4 |
| Molecular Weight | 595.75 g/mol |
| Exact Mass | 595.04 |
| IUPAC Name | N-(2-phenylphenyl)-3,5-bis(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | O=C(Nc1ccccc1-c1ccccc1)c1cc(NS(=O)(=O)c2cccs2)cc(NS(=O)(=O)c2cccs2)c1 |
| InChI | InChI=1S/C27H21N3O5S4/c31-27(28-24-11-5-4-10-23(24)19-8-2-1-3-9-19)20-16-21(29-38(32,33)25-12-6-14-36-25)18-22(17-20)30-39(34,35)26-13-7-15-37-26/h1-18,29-30H,(H,28,31) |
| InChIKey | VYDJZZQQYLTGLN-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.75 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |