C24H18N4O6S4 — CID 6519249
N-[(Z)-(3-oxoinden-1-ylidene)amino]-3,5-bis(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 6519249) has the molecular formula C24H18N4O6S4 and a molecular weight of 586.70 g/mol. Its IUPAC name is N-[(Z)-(3-oxoinden-1-ylidene)amino]-3,5-bis(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-[(Z)-(3-oxoinden-1-ylidene)amino]-3,5-bis(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 6519249 |
| Molecular Formula | C24H18N4O6S4 |
| Molecular Weight | 586.70 g/mol |
| Exact Mass | 586.01 |
| IUPAC Name | N-[(Z)-(3-oxoinden-1-ylidene)amino]-3,5-bis(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | O=C(N/N=C1/CC(=O)c2ccccc21)c1cc(NS(=O)(=O)c2cccs2)cc(NS(=O)(=O)c2cccs2)c1 |
| InChI | InChI=1S/C24H18N4O6S4/c29-21-14-20(18-5-1-2-6-19(18)21)25-26-24(30)15-11-16(27-37(31,32)22-7-3-9-35-22)13-17(12-15)28-38(33,34)23-8-4-10-36-23/h1-13,27-28H,14H2,(H,26,30)/b25-20- |
| InChIKey | VTLHYZRFEDMHAV-QQTULTPQSA-N |
| XLogP | 4.13 |
| TPSA | 150.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.70 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|