C19H18N4O5S5 — CID 5167189
N-(thiolan-3-ylideneamino)-3,5-bis(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 5167189) has the molecular formula C19H18N4O5S5 and a molecular weight of 542.71 g/mol. Its IUPAC name is N-(thiolan-3-ylideneamino)-3,5-bis(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-(thiolan-3-ylideneamino)-3,5-bis(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 5167189 |
| Molecular Formula | C19H18N4O5S5 |
| Molecular Weight | 542.71 g/mol |
| Exact Mass | 541.99 |
| IUPAC Name | N-(thiolan-3-ylideneamino)-3,5-bis(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | O=C(NN=C1CCSC1)c1cc(NS(=O)(=O)c2cccs2)cc(NS(=O)(=O)c2cccs2)c1 |
| InChI | InChI=1S/C19H18N4O5S5/c24-19(21-20-14-5-8-29-12-14)13-9-15(22-32(25,26)17-3-1-6-30-17)11-16(10-13)23-33(27,28)18-4-2-7-31-18/h1-4,6-7,9-11,22-23H,5,8,12H2,(H,21,24) |
| InChIKey | MZIOXMQENMUGQS-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 133.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.71 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|