C15H29N3O5 — CID 23547243
2-(hydroxymethyl)-6-[2-(2,2,6,6-tetramethylpiperidin-4-ylidene)hydrazinyl]oxane-3,4,5-triol (PubChem CID 23547243) has the molecular formula C15H29N3O5 and a molecular weight of 331.41 g/mol. Its IUPAC name is 2-(hydroxymethyl)-6-[2-(2,2,6,6-tetramethylpiperidin-4-ylidene)hydrazinyl]oxane-3,4,5-triol.
| Compound Name | 2-(hydroxymethyl)-6-[2-(2,2,6,6-tetramethylpiperidin-4-ylidene)hydrazinyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 23547243 |
| Molecular Formula | C15H29N3O5 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | 2-(hydroxymethyl)-6-[2-(2,2,6,6-tetramethylpiperidin-4-ylidene)hydrazinyl]oxane-3,4,5-triol |
| SMILES | CC1(C)CC(=NNC2OC(CO)C(O)C(O)C2O)CC(C)(C)N1 |
| InChI | InChI=1S/C15H29N3O5/c1-14(2)5-8(6-15(3,4)18-14)16-17-13-12(22)11(21)10(20)9(7-19)23-13/h9-13,17-22H,5-7H2,1-4H3 |
| InChIKey | DGYBPAQJJTZYTE-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 126.57 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|