C18H31NO5 — CID 25134431
(3R,4S,5R,6R)-2-[(3,5-dimethyl-1-adamantyl)amino]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 25134431) has the molecular formula C18H31NO5 and a molecular weight of 341.45 g/mol. Its IUPAC name is (3R,4S,5R,6R)-2-[(3,5-dimethyl-1-adamantyl)amino]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (3R,4S,5R,6R)-2-[(3,5-dimethyl-1-adamantyl)amino]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 25134431 |
| Molecular Formula | C18H31NO5 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | (3R,4S,5R,6R)-2-[(3,5-dimethyl-1-adamantyl)amino]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CC12CC3CC(C)(C1)CC(NC1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O)(C3)C2 |
| InChI | InChI=1S/C18H31NO5/c1-16-3-10-4-17(2,7-16)9-18(5-10,8-16)19-15-14(23)13(22)12(21)11(6-20)24-15/h10-15,19-23H,3-9H2,1-2H3/t10?,11-,12+,13+,14-,15?,16?,17?,18?/m1/s1 |
| InChIKey | DTKOOUFWRWMJGY-MDISXEILSA-N |
| XLogP | 0.12 |
| TPSA | 102.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |