C18H29NO6 — CID 71749947
(2S,3S,4S,5R,6R)-6-[[(3R,5S)-3,5-dimethyl-1-adamantyl]amino]-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 71749947) has the molecular formula C18H29NO6 and a molecular weight of 355.43 g/mol. Its IUPAC name is (2S,3S,4S,5R,6R)-6-[[(3R,5S)-3,5-dimethyl-1-adamantyl]amino]-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R,6R)-6-[[(3R,5S)-3,5-dimethyl-1-adamantyl]amino]-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 71749947 |
| Molecular Formula | C18H29NO6 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | (2S,3S,4S,5R,6R)-6-[[(3R,5S)-3,5-dimethyl-1-adamantyl]amino]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | C[C@]12CC3CC(N[C@@H]4O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]4O)(C1)C[C@@](C)(C3)C2 |
| InChI | InChI=1S/C18H29NO6/c1-16-3-9-4-17(2,6-16)8-18(5-9,7-16)19-14-12(22)10(20)11(21)13(25-14)15(23)24/h9-14,19-22H,3-8H2,1-2H3,(H,23,24)/t9?,10-,11-,12+,13-,14+,16-,17+,18?/m0/s1 |
| InChIKey | HYFLKMZNQYTCMY-RIZAZWALSA-N |
| XLogP | 0.22 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |