C29H24Cl2F7N3O — CID 23567635
N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-(3,4-dichlorophenyl)-4-[2-(5-fluoro-1H-indol-3-yl)ethylamino]butanamide (PubChem CID 23567635) has the molecular formula C29H24Cl2F7N3O and a molecular weight of 634.42 g/mol. Its IUPAC name is N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-(3,4-dichlorophenyl)-4-[2-(5-fluoro-1H-indol-3-yl)ethylamino]butanamide.
| Compound Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-(3,4-dichlorophenyl)-4-[2-(5-fluoro-1H-indol-3-yl)ethylamino]butanamide |
|---|---|
| PubChem CID | 23567635 |
| Molecular Formula | C29H24Cl2F7N3O |
| Molecular Weight | 634.42 g/mol |
| Exact Mass | 633.12 |
| IUPAC Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-(3,4-dichlorophenyl)-4-[2-(5-fluoro-1H-indol-3-yl)ethylamino]butanamide |
| SMILES | O=C(NCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(CCNCCc1c[nH]c2ccc(F)cc12)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C29H24Cl2F7N3O/c30-24-3-1-17(11-25(24)31)22(6-8-39-7-5-18-15-40-26-4-2-21(32)13-23(18)26)27(42)41-14-16-9-19(28(33,34)35)12-20(10-16)29(36,37)38/h1-4,9-13,15,22,39-40H,5-8,14H2,(H,41,42) |
| InChIKey | GDYIBKBSAUTWIE-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.42 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|